C10H18O4 — CID 135029161
(Z,4S)-5-[(2R,3S)-3-hydroxyoxan-2-yl]pent-2-ene-1,4-diol (PubChem CID 135029161) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (Z,4S)-5-[(2R,3S)-3-hydroxyoxan-2-yl]pent-2-ene-1,4-diol.
| Compound Name | (Z,4S)-5-[(2R,3S)-3-hydroxyoxan-2-yl]pent-2-ene-1,4-diol |
|---|---|
| PubChem CID | 135029161 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (Z,4S)-5-[(2R,3S)-3-hydroxyoxan-2-yl]pent-2-ene-1,4-diol |
| SMILES | OC/C=C\[C@@H](O)C[C@H]1OCCC[C@@H]1O |
| InChI | InChI=1S/C10H18O4/c11-5-1-3-8(12)7-10-9(13)4-2-6-14-10/h1,3,8-13H,2,4-7H2/b3-1-/t8-,9+,10-/m1/s1 |
| InChIKey | VLUAWJCXJPINGR-WADQILMQSA-N |
| XLogP | -0.17 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|