C21H40O3 — CID 14542125
[2-[(E)-heptadec-8-enyl]-1,3-dioxolan-4-yl]methanol (PubChem CID 14542125) has the molecular formula C21H40O3 and a molecular weight of 340.55 g/mol. Its IUPAC name is [2-[(E)-heptadec-8-enyl]-1,3-dioxolan-4-yl]methanol.
| Compound Name | [2-[(E)-heptadec-8-enyl]-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 14542125 |
| Molecular Formula | C21H40O3 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.30 |
| IUPAC Name | [2-[(E)-heptadec-8-enyl]-1,3-dioxolan-4-yl]methanol |
| SMILES | CCCCCCCC/C=C/CCCCCCCC1OCC(CO)O1 |
| InChI | InChI=1S/C21H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-23-19-20(18-22)24-21/h9-10,20-22H,2-8,11-19H2,1H3/b10-9+ |
| InChIKey | MFEIJHSKNDNTLA-MDZDMXLPSA-N |
| XLogP | 5.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|