C13H22O5 — CID 14558246
(2R,3aS,5R,6R,7aS)-5-[(E,2S)-2-hydroxypent-3-enyl]-2-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-ol (PubChem CID 14558246) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is (2R,3aS,5R,6R,7aS)-5-[(E,2S)-2-hydroxypent-3-enyl]-2-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-ol.
| Compound Name | (2R,3aS,5R,6R,7aS)-5-[(E,2S)-2-hydroxypent-3-enyl]-2-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-ol |
|---|---|
| PubChem CID | 14558246 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (2R,3aS,5R,6R,7aS)-5-[(E,2S)-2-hydroxypent-3-enyl]-2-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-ol |
| SMILES | C/C=C/[C@@H](O)C[C@H]1O[C@H]2C[C@H](OC)O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C13H22O5/c1-3-4-8(14)5-10-9(15)6-11-12(17-10)7-13(16-2)18-11/h3-4,8-15H,5-7H2,1-2H3/b4-3+/t8-,9-,10-,11+,12+,13-/m1/s1 |
| InChIKey | VWPUQUQRTUMRBL-DRTUEGJOSA-N |
| XLogP | 0.59 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|