C19H13N5O — CID 142717491
2-[(5-phenyltetrazol-2-yl)methyl]furo[3,2-c]quinoline (PubChem CID 142717491) has the molecular formula C19H13N5O and a molecular weight of 327.35 g/mol. Its IUPAC name is 2-[(5-phenyltetrazol-2-yl)methyl]furo[3,2-c]quinoline.
| Compound Name | 2-[(5-phenyltetrazol-2-yl)methyl]furo[3,2-c]quinoline |
|---|---|
| PubChem CID | 142717491 |
| Molecular Formula | C19H13N5O |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-[(5-phenyltetrazol-2-yl)methyl]furo[3,2-c]quinoline |
| SMILES | c1ccc(-c2nnn(Cc3cc4cnc5ccccc5c4o3)n2)cc1 |
| InChI | InChI=1S/C19H13N5O/c1-2-6-13(7-3-1)19-21-23-24(22-19)12-15-10-14-11-20-17-9-5-4-8-16(17)18(14)25-15/h1-11H,12H2 |
| InChIKey | ZVVFFGZBDVHMSL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |