C14H12N2O3 — CID 142717474
3-amino-3-furo[3,2-c]quinolin-2-ylpropanoic acid (PubChem CID 142717474) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 3-amino-3-furo[3,2-c]quinolin-2-ylpropanoic acid.
| Compound Name | 3-amino-3-furo[3,2-c]quinolin-2-ylpropanoic acid |
|---|---|
| PubChem CID | 142717474 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 3-amino-3-furo[3,2-c]quinolin-2-ylpropanoic acid |
| SMILES | NC(CC(=O)O)c1cc2cnc3ccccc3c2o1 |
| InChI | InChI=1S/C14H12N2O3/c15-10(6-13(17)18)12-5-8-7-16-11-4-2-1-3-9(11)14(8)19-12/h1-5,7,10H,6,15H2,(H,17,18) |
| InChIKey | IFAWTHOGBALABG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |