C23H30NO5S2+ — CID 142717741
3-[4-[hydroxy(piperidin-1-ium-1-ylidene)methoxy]-2,3,5,6-tetramethylphenyl]sulfanyl-4-methylbenzenesulfonic acid (PubChem CID 142717741) has the molecular formula C23H30NO5S2+ and a molecular weight of 464.63 g/mol. Its IUPAC name is 3-[4-[hydroxy(piperidin-1-ium-1-ylidene)methoxy]-2,3,5,6-tetramethylphenyl]sulfanyl-4-methylbenzenesulfonic acid.
| Compound Name | 3-[4-[hydroxy(piperidin-1-ium-1-ylidene)methoxy]-2,3,5,6-tetramethylphenyl]sulfanyl-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 142717741 |
| Molecular Formula | C23H30NO5S2+ |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 3-[4-[hydroxy(piperidin-1-ium-1-ylidene)methoxy]-2,3,5,6-tetramethylphenyl]sulfanyl-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1Sc1c(C)c(C)c(OC(O)=[N+]2CCCCC2)c(C)c1C |
| InChI | InChI=1S/C23H29NO5S2/c1-14-9-10-19(31(26,27)28)13-20(14)30-22-17(4)15(2)21(16(3)18(22)5)29-23(25)24-11-7-6-8-12-24/h9-10,13H,6-8,11-12H2,1-5H3,(H,26,27,28)/p+1 |
| InChIKey | DXGSYCVUHBCQEC-UHFFFAOYSA-O |
| XLogP | 5.12 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|