C17H21NO3S2 — CID 174996275
4-methyl-3-phenylsulfanylbenzenesulfonic acid;pyrrolidine (PubChem CID 174996275) has the molecular formula C17H21NO3S2 and a molecular weight of 351.49 g/mol. Its IUPAC name is 4-methyl-3-phenylsulfanylbenzenesulfonic acid;pyrrolidine.
| Compound Name | 4-methyl-3-phenylsulfanylbenzenesulfonic acid;pyrrolidine |
|---|---|
| PubChem CID | 174996275 |
| Molecular Formula | C17H21NO3S2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 4-methyl-3-phenylsulfanylbenzenesulfonic acid;pyrrolidine |
| SMILES | C1CCNC1.Cc1ccc(S(=O)(=O)O)cc1Sc1ccccc1 |
| InChI | InChI=1S/C13H12O3S2.C4H9N/c1-10-7-8-12(18(14,15)16)9-13(10)17-11-5-3-2-4-6-11;1-2-4-5-3-1/h2-9H,1H3,(H,14,15,16);5H,1-4H2 |
| InChIKey | CGRJIQYRABEDRL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|