C7H6BrIO — CID 142719289
3-(bromomethyl)-1λ3-iodacyclohexa-1,3,5-triene-4-carbaldehyde (PubChem CID 142719289) has the molecular formula C7H6BrIO and a molecular weight of 312.93 g/mol. Its IUPAC name is 3-(bromomethyl)-1λ3-iodacyclohexa-1,3,5-triene-4-carbaldehyde.
| Compound Name | 3-(bromomethyl)-1λ3-iodacyclohexa-1,3,5-triene-4-carbaldehyde |
|---|---|
| PubChem CID | 142719289 |
| Molecular Formula | C7H6BrIO |
| Molecular Weight | 312.93 g/mol |
| Exact Mass | 311.86 |
| IUPAC Name | 3-(bromomethyl)-1λ3-iodacyclohexa-1,3,5-triene-4-carbaldehyde |
| SMILES | O=CC1=C(CBr)C=IC=C1 |
| InChI | InChI=1S/C7H6BrIO/c8-3-7-4-9-2-1-6(7)5-10/h1-2,4-5H,3H2 |
| InChIKey | QFNCQFLRNDNPGR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.93 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|