C17H23BrN2O2 — CID 142720703
butyl 1-(4-bromophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate (PubChem CID 142720703) has the molecular formula C17H23BrN2O2 and a molecular weight of 367.29 g/mol. Its IUPAC name is butyl 1-(4-bromophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate.
| Compound Name | butyl 1-(4-bromophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 142720703 |
| Molecular Formula | C17H23BrN2O2 |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | butyl 1-(4-bromophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate |
| SMILES | CCCCOC(=O)N1CC2CCN(c3ccc(Br)cc3)C2C1 |
| InChI | InChI=1S/C17H23BrN2O2/c1-2-3-10-22-17(21)19-11-13-8-9-20(16(13)12-19)15-6-4-14(18)5-7-15/h4-7,13,16H,2-3,8-12H2,1H3 |
| InChIKey | XVGUHMMPLYXFSY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|