C18H23BrN2O3 — CID 175809562
butyl 4-(6-bromo-3-oxo-1H-isoindol-2-yl)piperidine-1-carboxylate (PubChem CID 175809562) has the molecular formula C18H23BrN2O3 and a molecular weight of 395.30 g/mol. Its IUPAC name is butyl 4-(6-bromo-3-oxo-1H-isoindol-2-yl)piperidine-1-carboxylate.
| Compound Name | butyl 4-(6-bromo-3-oxo-1H-isoindol-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175809562 |
| Molecular Formula | C18H23BrN2O3 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | butyl 4-(6-bromo-3-oxo-1H-isoindol-2-yl)piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(N2Cc3cc(Br)ccc3C2=O)CC1 |
| InChI | InChI=1S/C18H23BrN2O3/c1-2-3-10-24-18(23)20-8-6-15(7-9-20)21-12-13-11-14(19)4-5-16(13)17(21)22/h4-5,11,15H,2-3,6-10,12H2,1H3 |
| InChIKey | WCOWSFTYMCXAES-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|