C19H27FN2O2 — CID 175809408
butyl 4-(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)piperidine-1-carboxylate (PubChem CID 175809408) has the molecular formula C19H27FN2O2 and a molecular weight of 334.44 g/mol. Its IUPAC name is butyl 4-(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)piperidine-1-carboxylate.
| Compound Name | butyl 4-(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175809408 |
| Molecular Formula | C19H27FN2O2 |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | butyl 4-(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(N2CCc3c(F)cccc3C2)CC1 |
| InChI | InChI=1S/C19H27FN2O2/c1-2-3-13-24-19(23)21-10-7-16(8-11-21)22-12-9-17-15(14-22)5-4-6-18(17)20/h4-6,16H,2-3,7-14H2,1H3 |
| InChIKey | JYRCBCBVDKAENY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|