C29H38O5 — CID 142722211
ethyl 2-[4-[3-(2-hexoxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoate (PubChem CID 142722211) has the molecular formula C29H38O5 and a molecular weight of 466.62 g/mol. Its IUPAC name is ethyl 2-[4-[3-(2-hexoxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[4-[3-(2-hexoxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 142722211 |
| Molecular Formula | C29H38O5 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | ethyl 2-[4-[3-(2-hexoxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoate |
| SMILES | CCCCCCOc1ccccc1C(=O)C=Cc1cc(C)c(OC(C)(C)C(=O)OCC)c(C)c1 |
| InChI | InChI=1S/C29H38O5/c1-7-9-10-13-18-33-26-15-12-11-14-24(26)25(30)17-16-23-19-21(3)27(22(4)20-23)34-29(5,6)28(31)32-8-2/h11-12,14-17,19-20H,7-10,13,18H2,1-6H3 |
| InChIKey | KWFNYBOBALSCDQ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|