C31H42O5 — CID 91141712
tert-butyl 2-[4-[3-(2-hexoxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoate (PubChem CID 91141712) has the molecular formula C31H42O5 and a molecular weight of 494.67 g/mol. Its IUPAC name is tert-butyl 2-[4-[3-(2-hexoxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoate.
| Compound Name | tert-butyl 2-[4-[3-(2-hexoxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 91141712 |
| Molecular Formula | C31H42O5 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | tert-butyl 2-[4-[3-(2-hexoxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoate |
| SMILES | CCCCCCOc1ccccc1C(=O)C=Cc1cc(C)c(OC(C)(C)C(=O)OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C31H42O5/c1-9-10-11-14-19-34-27-16-13-12-15-25(27)26(32)18-17-24-20-22(2)28(23(3)21-24)35-31(7,8)29(33)36-30(4,5)6/h12-13,15-18,20-21H,9-11,14,19H2,1-8H3 |
| InChIKey | KRCFUKNYGDTRCO-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|