C33H44O5S — CID 67216982
tert-butyl 2-[4-[3-[4-(2-cyclohexylsulfanylethoxy)phenyl]-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoate (PubChem CID 67216982) has the molecular formula C33H44O5S and a molecular weight of 552.78 g/mol. Its IUPAC name is tert-butyl 2-[4-[3-[4-(2-cyclohexylsulfanylethoxy)phenyl]-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoate.
| Compound Name | tert-butyl 2-[4-[3-[4-(2-cyclohexylsulfanylethoxy)phenyl]-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 67216982 |
| Molecular Formula | C33H44O5S |
| Molecular Weight | 552.78 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | tert-butyl 2-[4-[3-[4-(2-cyclohexylsulfanylethoxy)phenyl]-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoate |
| SMILES | Cc1cc(C=CC(=O)c2ccc(OCCSC3CCCCC3)cc2)cc(C)c1OC(C)(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H44O5S/c1-23-21-25(22-24(2)30(23)37-33(6,7)31(35)38-32(3,4)5)13-18-29(34)26-14-16-27(17-15-26)36-19-20-39-28-11-9-8-10-12-28/h13-18,21-22,28H,8-12,19-20H2,1-7H3 |
| InChIKey | MOCHUZJXFXHOIW-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.78 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|