C29H35BrO4 — CID 90897796
tert-butyl 2-[4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexylphenoxy]-2-methylpropanoate (PubChem CID 90897796) has the molecular formula C29H35BrO4 and a molecular weight of 527.50 g/mol. Its IUPAC name is tert-butyl 2-[4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexylphenoxy]-2-methylpropanoate.
| Compound Name | tert-butyl 2-[4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexylphenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 90897796 |
| Molecular Formula | C29H35BrO4 |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | tert-butyl 2-[4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexylphenoxy]-2-methylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)Oc1ccc(C=CC(=O)c2ccc(Br)cc2)cc1C1CCCCC1 |
| InChI | InChI=1S/C29H35BrO4/c1-28(2,3)34-27(32)29(4,5)33-26-18-12-20(19-24(26)21-9-7-6-8-10-21)11-17-25(31)22-13-15-23(30)16-14-22/h11-19,21H,6-10H2,1-5H3 |
| InChIKey | PZVUJIUJUKLUSL-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|