C19H15BrCl2O4 — CID 25062862
2-[4-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]-2,3-dichlorophenoxy]-2-methylpropanoic acid (PubChem CID 25062862) has the molecular formula C19H15BrCl2O4 and a molecular weight of 458.14 g/mol. Its IUPAC name is 2-[4-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]-2,3-dichlorophenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]-2,3-dichlorophenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 25062862 |
| Molecular Formula | C19H15BrCl2O4 |
| Molecular Weight | 458.14 g/mol |
| Exact Mass | 455.95 |
| IUPAC Name | 2-[4-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]-2,3-dichlorophenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1ccc(/C=C/C(=O)c2ccc(Br)cc2)c(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C19H15BrCl2O4/c1-19(2,18(24)25)26-15-10-6-12(16(21)17(15)22)5-9-14(23)11-3-7-13(20)8-4-11/h3-10H,1-2H3,(H,24,25)/b9-5+ |
| InChIKey | MXDFGRCHTJVZPY-WEVVVXLNSA-N |
| XLogP | 5.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.14 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|