C22H21BrCl2O4 — CID 89260379
tert-butyl 2-[4-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]-2,3-dichlorophenoxy]propanoate (PubChem CID 89260379) has the molecular formula C22H21BrCl2O4 and a molecular weight of 500.22 g/mol. Its IUPAC name is tert-butyl 2-[4-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]-2,3-dichlorophenoxy]propanoate.
| Compound Name | tert-butyl 2-[4-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]-2,3-dichlorophenoxy]propanoate |
|---|---|
| PubChem CID | 89260379 |
| Molecular Formula | C22H21BrCl2O4 |
| Molecular Weight | 500.22 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | tert-butyl 2-[4-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]-2,3-dichlorophenoxy]propanoate |
| SMILES | CC(Oc1ccc(/C=C/C(=O)c2ccc(Br)cc2)c(Cl)c1Cl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H21BrCl2O4/c1-13(21(27)29-22(2,3)4)28-18-12-8-15(19(24)20(18)25)7-11-17(26)14-5-9-16(23)10-6-14/h5-13H,1-4H3/b11-7+ |
| InChIKey | QXFJPERYPVDRQW-YRNVUSSQSA-N |
| XLogP | 6.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.22 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|