C17H20BrNO5 — CID 155540746
2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl (E)-4-(4-bromophenyl)-4-oxobut-2-enoate (PubChem CID 155540746) has the molecular formula C17H20BrNO5 and a molecular weight of 398.25 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl (E)-4-(4-bromophenyl)-4-oxobut-2-enoate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl (E)-4-(4-bromophenyl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 155540746 |
| Molecular Formula | C17H20BrNO5 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl (E)-4-(4-bromophenyl)-4-oxobut-2-enoate |
| SMILES | CC(C)(C)OC(=O)NCCOC(=O)/C=C/C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H20BrNO5/c1-17(2,3)24-16(22)19-10-11-23-15(21)9-8-14(20)12-4-6-13(18)7-5-12/h4-9H,10-11H2,1-3H3,(H,19,22)/b9-8+ |
| InChIKey | RPUNBQQEWLVURT-CMDGGOBGSA-N |
| XLogP | 3.26 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|