C27H24N2O5S — CID 142722310
(2S)-3-(3,4-dimethoxyphenyl)-2-(pyren-1-ylsulfonylamino)propanamide (PubChem CID 142722310) has the molecular formula C27H24N2O5S and a molecular weight of 488.57 g/mol. Its IUPAC name is (2S)-3-(3,4-dimethoxyphenyl)-2-(pyren-1-ylsulfonylamino)propanamide.
| Compound Name | (2S)-3-(3,4-dimethoxyphenyl)-2-(pyren-1-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 142722310 |
| Molecular Formula | C27H24N2O5S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | (2S)-3-(3,4-dimethoxyphenyl)-2-(pyren-1-ylsulfonylamino)propanamide |
| SMILES | COc1ccc(C[C@H](NS(=O)(=O)c2ccc3ccc4cccc5ccc2c3c45)C(N)=O)cc1OC |
| InChI | InChI=1S/C27H24N2O5S/c1-33-22-12-6-16(15-23(22)34-2)14-21(27(28)30)29-35(31,32)24-13-10-19-8-7-17-4-3-5-18-9-11-20(24)26(19)25(17)18/h3-13,15,21,29H,14H2,1-2H3,(H2,28,30)/t21-/m0/s1 |
| InChIKey | UTYPFOPJXZQUHQ-NRFANRHFSA-N |
| XLogP | 3.98 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|