C19H27F3N2O3 — CID 142725669
tert-butyl 4-[2-[[4-(trifluoromethyl)phenyl]methoxy]ethyl]piperazine-1-carboxylate (PubChem CID 142725669) has the molecular formula C19H27F3N2O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is tert-butyl 4-[2-[[4-(trifluoromethyl)phenyl]methoxy]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[4-(trifluoromethyl)phenyl]methoxy]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142725669 |
| Molecular Formula | C19H27F3N2O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | tert-butyl 4-[2-[[4-(trifluoromethyl)phenyl]methoxy]ethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCOCc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H27F3N2O3/c1-18(2,3)27-17(25)24-10-8-23(9-11-24)12-13-26-14-15-4-6-16(7-5-15)19(20,21)22/h4-7H,8-14H2,1-3H3 |
| InChIKey | SQTAVOYZLTUIGT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|