C21H22O2 — CID 142726642
1-naphthalen-1-ylundeca-2,4-diyne-1,6-diol (PubChem CID 142726642) has the molecular formula C21H22O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-naphthalen-1-ylundeca-2,4-diyne-1,6-diol.
| Compound Name | 1-naphthalen-1-ylundeca-2,4-diyne-1,6-diol |
|---|---|
| PubChem CID | 142726642 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-naphthalen-1-ylundeca-2,4-diyne-1,6-diol |
| SMILES | CCCCCC(O)C#CC#CC(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H22O2/c1-2-3-4-12-18(22)13-6-8-16-21(23)20-15-9-11-17-10-5-7-14-19(17)20/h5,7,9-11,14-15,18,21-23H,2-4,12H2,1H3 |
| InChIKey | HXUKBDITVPYXFG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|