C21H14O — CID 101184195
1-naphthalen-1-yl-5-phenylpenta-2,4-diyn-1-ol (PubChem CID 101184195) has the molecular formula C21H14O and a molecular weight of 282.34 g/mol. Its IUPAC name is 1-naphthalen-1-yl-5-phenylpenta-2,4-diyn-1-ol.
| Compound Name | 1-naphthalen-1-yl-5-phenylpenta-2,4-diyn-1-ol |
|---|---|
| PubChem CID | 101184195 |
| Molecular Formula | C21H14O |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-naphthalen-1-yl-5-phenylpenta-2,4-diyn-1-ol |
| SMILES | OC(C#CC#Cc1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H14O/c22-21(16-7-4-11-17-9-2-1-3-10-17)20-15-8-13-18-12-5-6-14-19(18)20/h1-3,5-6,8-10,12-15,21-22H |
| InChIKey | DMRUCUIEHFCMAJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|