C13H12O3 — CID 18534060
7-phenylhepta-4,6-diyne-1,2,3-triol (PubChem CID 18534060) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is 7-phenylhepta-4,6-diyne-1,2,3-triol.
| Compound Name | 7-phenylhepta-4,6-diyne-1,2,3-triol |
|---|---|
| PubChem CID | 18534060 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 7-phenylhepta-4,6-diyne-1,2,3-triol |
| SMILES | OCC(O)C(O)C#CC#Cc1ccccc1 |
| InChI | InChI=1S/C13H12O3/c14-10-13(16)12(15)9-5-4-8-11-6-2-1-3-7-11/h1-3,6-7,12-16H,10H2 |
| InChIKey | DJTPAMNBANNQOP-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|