C24H26N4O9 — CID 142729882
[(2S)-4-amino-1-[(2S)-4-amino-3-benzyl-2-(carboxyamino)-4-oxobutanoyl]oxy-3-benzyl-1,4-dioxobutan-2-yl]carbamic acid (PubChem CID 142729882) has the molecular formula C24H26N4O9 and a molecular weight of 514.49 g/mol. Its IUPAC name is [(2S)-4-amino-1-[(2S)-4-amino-3-benzyl-2-(carboxyamino)-4-oxobutanoyl]oxy-3-benzyl-1,4-dioxobutan-2-yl]carbamic acid.
| Compound Name | [(2S)-4-amino-1-[(2S)-4-amino-3-benzyl-2-(carboxyamino)-4-oxobutanoyl]oxy-3-benzyl-1,4-dioxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 142729882 |
| Molecular Formula | C24H26N4O9 |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | [(2S)-4-amino-1-[(2S)-4-amino-3-benzyl-2-(carboxyamino)-4-oxobutanoyl]oxy-3-benzyl-1,4-dioxobutan-2-yl]carbamic acid |
| SMILES | NC(=O)C(Cc1ccccc1)[C@H](NC(=O)O)C(=O)OC(=O)[C@@H](NC(=O)O)C(Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C24H26N4O9/c25-19(29)15(11-13-7-3-1-4-8-13)17(27-23(33)34)21(31)37-22(32)18(28-24(35)36)16(20(26)30)12-14-9-5-2-6-10-14/h1-10,15-18,27-28H,11-12H2,(H2,25,29)(H2,26,30)(H,33,34)(H,35,36)/t15?,16?,17-,18-/m0/s1 |
| InChIKey | OWKPLROAMRTIFS-FOIPXRHGSA-N |
| XLogP | 0.02 |
| TPSA | 228.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|