C29H38O4 — CID 142731402
1,3-dibutyl-2,7-di(propan-2-yl)fluorene-9,9-dicarboxylic acid (PubChem CID 142731402) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is 1,3-dibutyl-2,7-di(propan-2-yl)fluorene-9,9-dicarboxylic acid.
| Compound Name | 1,3-dibutyl-2,7-di(propan-2-yl)fluorene-9,9-dicarboxylic acid |
|---|---|
| PubChem CID | 142731402 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 1,3-dibutyl-2,7-di(propan-2-yl)fluorene-9,9-dicarboxylic acid |
| SMILES | CCCCc1cc2c(c(CCCC)c1C(C)C)C(C(=O)O)(C(=O)O)c1cc(C(C)C)ccc1-2 |
| InChI | InChI=1S/C29H38O4/c1-7-9-11-20-15-23-21-14-13-19(17(3)4)16-24(21)29(27(30)31,28(32)33)26(23)22(12-10-8-2)25(20)18(5)6/h13-18H,7-12H2,1-6H3,(H,30,31)(H,32,33) |
| InChIKey | KWXXKHTXZLQNAL-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|