C23H21N3O2S — CID 142731883
5-amino-N-(4-ethylphenyl)-2-oxo-1-(thiophen-2-ylmethyl)quinoline-3-carboxamide (PubChem CID 142731883) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is 5-amino-N-(4-ethylphenyl)-2-oxo-1-(thiophen-2-ylmethyl)quinoline-3-carboxamide.
| Compound Name | 5-amino-N-(4-ethylphenyl)-2-oxo-1-(thiophen-2-ylmethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 142731883 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 5-amino-N-(4-ethylphenyl)-2-oxo-1-(thiophen-2-ylmethyl)quinoline-3-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2cc3c(N)cccc3n(Cc3cccs3)c2=O)cc1 |
| InChI | InChI=1S/C23H21N3O2S/c1-2-15-8-10-16(11-9-15)25-22(27)19-13-18-20(24)6-3-7-21(18)26(23(19)28)14-17-5-4-12-29-17/h3-13H,2,14,24H2,1H3,(H,25,27) |
| InChIKey | AMFREVUAHUUKOL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|