C16H12N4O5S — CID 121026039
N-(3-nitrophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide (PubChem CID 121026039) has the molecular formula C16H12N4O5S and a molecular weight of 372.36 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(3-nitrophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121026039 |
| Molecular Formula | C16H12N4O5S |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | N-(3-nitrophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)c1c[nH]c(=O)n(Cc2cccs2)c1=O |
| InChI | InChI=1S/C16H12N4O5S/c21-14(18-10-3-1-4-11(7-10)20(24)25)13-8-17-16(23)19(15(13)22)9-12-5-2-6-26-12/h1-8H,9H2,(H,17,23)(H,18,21) |
| InChIKey | YQXHESGKMURZLI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|