About N-(2-cyanophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide
N-(2-cyanophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide (PubChem CID 121026131) has the molecular formula C17H12N4O3S
and a molecular weight of 352.38 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | N-(2-cyanophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide |
| PubChem CID | 121026131 |
| Molecular Formula | C17H12N4O3S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | N-(2-cyanophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide |
| SMILES | N#Cc1ccccc1NC(=O)c1c[nH]c(=O)n(Cc2cccs2)c1=O |
| InChI | InChI=1S/C17H12N4O3S/c18-8-11-4-1-2-6-14(11)20-15(22)13-9-19-17(24)21(16(13)23)10-12-5-3-7-25-12/h1-7,9H,10H2,(H,19,24)(H,20,22) |
| InChIKey | HKMAVFKATSRWQW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 107.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2-cyanophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide?
The IUPAC name of N-(2-cyanophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide (CID 121026131) is N-(2-cyanophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide.
What is the SMILES notation for N-(2-cyanophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide?
The canonical SMILES for N-(2-cyanophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide is N#Cc1ccccc1NC(=O)c1c[nH]c(=O)n(Cc2cccs2)c1=O.
What is the InChIKey of N-(2-cyanophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide?
The InChIKey is HKMAVFKATSRWQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N4O3S/c18-8-11-4-1-2-6-14(11)20-15(22)13-9-19-17(24)21(16(13)23)10-12-5-3-7-25-12/h1-7,9H,10H2,(H,19,24)(H,20,22).
What are the key properties of N-(2-cyanophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide?
N-(2-cyanophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide has a molecular weight of 352.38 g/mol, XLogP of 1.77, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanophenyl)-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide is sourced from PubChem (CID 121026131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).