C22H16F3N3O2S — CID 142732080
1-(4-methylphenyl)sulfonyl-4-[2-[4-(trifluoromethyl)phenyl]phenyl]triazole (PubChem CID 142732080) has the molecular formula C22H16F3N3O2S and a molecular weight of 443.45 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-4-[2-[4-(trifluoromethyl)phenyl]phenyl]triazole.
| Compound Name | 1-(4-methylphenyl)sulfonyl-4-[2-[4-(trifluoromethyl)phenyl]phenyl]triazole |
|---|---|
| PubChem CID | 142732080 |
| Molecular Formula | C22H16F3N3O2S |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-4-[2-[4-(trifluoromethyl)phenyl]phenyl]triazole |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ccccc3-c3ccc(C(F)(F)F)cc3)nn2)cc1 |
| InChI | InChI=1S/C22H16F3N3O2S/c1-15-6-12-18(13-7-15)31(29,30)28-14-21(26-27-28)20-5-3-2-4-19(20)16-8-10-17(11-9-16)22(23,24)25/h2-14H,1H3 |
| InChIKey | KZAFOAHDRMMIIW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |