C26H22ClF4N3O6S2 — CID 142732800
benzoylsulfanyl 3-[2-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]sulfanylpropanoyl-methylamino]propanoate (PubChem CID 142732800) has the molecular formula C26H22ClF4N3O6S2 and a molecular weight of 648.06 g/mol. Its IUPAC name is benzoylsulfanyl 3-[2-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]sulfanylpropanoyl-methylamino]propanoate.
| Compound Name | benzoylsulfanyl 3-[2-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]sulfanylpropanoyl-methylamino]propanoate |
|---|---|
| PubChem CID | 142732800 |
| Molecular Formula | C26H22ClF4N3O6S2 |
| Molecular Weight | 648.06 g/mol |
| Exact Mass | 647.06 |
| IUPAC Name | benzoylsulfanyl 3-[2-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenyl]sulfanylpropanoyl-methylamino]propanoate |
| SMILES | CC(Sc1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)c(F)cc1Cl)C(=O)N(C)CCC(=O)OSC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H22ClF4N3O6S2/c1-14(23(37)32(2)10-9-22(36)40-42-24(38)15-7-5-4-6-8-15)41-19-12-18(17(28)11-16(19)27)34-21(35)13-20(26(29,30)31)33(3)25(34)39/h4-8,11-14H,9-10H2,1-3H3 |
| InChIKey | KNTYDVRXYNSHEJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 107.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.06 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|