C20H14FN3O2 — CID 14273474
(4-cyano-3-fluorophenyl) 4-(5-ethylpyrimidin-2-yl)benzoate (PubChem CID 14273474) has the molecular formula C20H14FN3O2 and a molecular weight of 347.35 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 4-(5-ethylpyrimidin-2-yl)benzoate.
| Compound Name | (4-cyano-3-fluorophenyl) 4-(5-ethylpyrimidin-2-yl)benzoate |
|---|---|
| PubChem CID | 14273474 |
| Molecular Formula | C20H14FN3O2 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 4-(5-ethylpyrimidin-2-yl)benzoate |
| SMILES | CCc1cnc(-c2ccc(C(=O)Oc3ccc(C#N)c(F)c3)cc2)nc1 |
| InChI | InChI=1S/C20H14FN3O2/c1-2-13-11-23-19(24-12-13)14-3-5-15(6-4-14)20(25)26-17-8-7-16(10-22)18(21)9-17/h3-9,11-12H,2H2,1H3 |
| InChIKey | VLJVVFWHFUTTIO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|