C21H20N4O2 — CID 46888230
(E)-3-(2,4-diaminopyrimidin-5-yl)-1-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-en-1-one (PubChem CID 46888230) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is (E)-3-(2,4-diaminopyrimidin-5-yl)-1-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,4-diaminopyrimidin-5-yl)-1-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 46888230 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (E)-3-(2,4-diaminopyrimidin-5-yl)-1-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-en-1-one |
| SMILES | Cc1ccc(COc2ccc(C(=O)/C=C/c3cnc(N)nc3N)cc2)cc1 |
| InChI | InChI=1S/C21H20N4O2/c1-14-2-4-15(5-3-14)13-27-18-9-6-16(7-10-18)19(26)11-8-17-12-24-21(23)25-20(17)22/h2-12H,13H2,1H3,(H4,22,23,24,25)/b11-8+ |
| InChIKey | UPIRPTAUDCZLPJ-DHZHZOJOSA-N |
| XLogP | 3.42 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|