C26H33N5O6S — CID 142735016
2-(2-amino-4-pyridinyl)-5-[5-[[(5E)-5-ethoxyimino-7,8-dihydro-6H-naphthalen-2-yl]oxy]pentyl]-1,2,5-thiadiazole-1,1-dicarboxylic acid (PubChem CID 142735016) has the molecular formula C26H33N5O6S and a molecular weight of 543.65 g/mol. Its IUPAC name is 2-(2-amino-4-pyridinyl)-5-[5-[[(5E)-5-ethoxyimino-7,8-dihydro-6H-naphthalen-2-yl]oxy]pentyl]-1,2,5-thiadiazole-1,1-dicarboxylic acid.
| Compound Name | 2-(2-amino-4-pyridinyl)-5-[5-[[(5E)-5-ethoxyimino-7,8-dihydro-6H-naphthalen-2-yl]oxy]pentyl]-1,2,5-thiadiazole-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 142735016 |
| Molecular Formula | C26H33N5O6S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 2-(2-amino-4-pyridinyl)-5-[5-[[(5E)-5-ethoxyimino-7,8-dihydro-6H-naphthalen-2-yl]oxy]pentyl]-1,2,5-thiadiazole-1,1-dicarboxylic acid |
| SMILES | CCO/N=C1\CCCc2cc(OCCCCCN3C=CN(c4ccnc(N)c4)S3(C(=O)O)C(=O)O)ccc21 |
| InChI | InChI=1S/C26H33N5O6S/c1-2-37-29-23-8-6-7-19-17-21(9-10-22(19)23)36-16-5-3-4-13-30-14-15-31(20-11-12-28-24(27)18-20)38(30,25(32)33)26(34)35/h9-12,14-15,17-18H,2-8,13,16H2,1H3,(H2,27,28)(H,32,33)(H,34,35)/b29-23+ |
| InChIKey | CIEPRJKZMLWXIO-BYNJWEBRSA-N |
| XLogP | 5.57 |
| TPSA | 150.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|