C11H8BrCl2N — CID 142735286
2-bromo-1-[(2,5-dichlorophenyl)methyl]pyrrole (PubChem CID 142735286) has the molecular formula C11H8BrCl2N and a molecular weight of 305.00 g/mol. Its IUPAC name is 2-bromo-1-[(2,5-dichlorophenyl)methyl]pyrrole.
| Compound Name | 2-bromo-1-[(2,5-dichlorophenyl)methyl]pyrrole |
|---|---|
| PubChem CID | 142735286 |
| Molecular Formula | C11H8BrCl2N |
| Molecular Weight | 305.00 g/mol |
| Exact Mass | 302.92 |
| IUPAC Name | 2-bromo-1-[(2,5-dichlorophenyl)methyl]pyrrole |
| SMILES | Clc1ccc(Cl)c(Cn2cccc2Br)c1 |
| InChI | InChI=1S/C11H8BrCl2N/c12-11-2-1-5-15(11)7-8-6-9(13)3-4-10(8)14/h1-6H,7H2 |
| InChIKey | YUIICKBXDMRUGR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.00 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |