C14H18N2 — CID 142736205
3-naphthalen-1-ylbutane-1,2-diamine (PubChem CID 142736205) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 3-naphthalen-1-ylbutane-1,2-diamine.
| Compound Name | 3-naphthalen-1-ylbutane-1,2-diamine |
|---|---|
| PubChem CID | 142736205 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 3-naphthalen-1-ylbutane-1,2-diamine |
| SMILES | CC(c1cccc2ccccc12)C(N)CN |
| InChI | InChI=1S/C14H18N2/c1-10(14(16)9-15)12-8-4-6-11-5-2-3-7-13(11)12/h2-8,10,14H,9,15-16H2,1H3 |
| InChIKey | FBHKMRAOOLSZHC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |