C32H27NO5S — CID 142736390
(4R)-4-[2-(4-methoxyphenyl)-2-oxoethyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4H-quinoline-3-carbaldehyde (PubChem CID 142736390) has the molecular formula C32H27NO5S and a molecular weight of 537.64 g/mol. Its IUPAC name is (4R)-4-[2-(4-methoxyphenyl)-2-oxoethyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4H-quinoline-3-carbaldehyde.
| Compound Name | (4R)-4-[2-(4-methoxyphenyl)-2-oxoethyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4H-quinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 142736390 |
| Molecular Formula | C32H27NO5S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | (4R)-4-[2-(4-methoxyphenyl)-2-oxoethyl]-1-(4-methylphenyl)sulfonyl-2-phenyl-4H-quinoline-3-carbaldehyde |
| SMILES | COc1ccc(C(=O)C[C@H]2C(C=O)=C(c3ccccc3)N(S(=O)(=O)c3ccc(C)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C32H27NO5S/c1-22-12-18-26(19-13-22)39(36,37)33-30-11-7-6-10-27(30)28(20-31(35)23-14-16-25(38-2)17-15-23)29(21-34)32(33)24-8-4-3-5-9-24/h3-19,21,28H,20H2,1-2H3/t28-/m1/s1 |
| InChIKey | LBFIFDUAWTVOFD-MUUNZHRXSA-N |
| XLogP | 6.18 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|