About 6-thiophen-3-ylfuro[2,3-h]quinoline
6-thiophen-3-ylfuro[2,3-h]quinoline (PubChem CID 142737835) has the molecular formula C15H9NOS
and a molecular weight of 251.31 g/mol. Its IUPAC name is 6-thiophen-3-ylfuro[2,3-h]quinoline.
Molecular Properties
| Compound Name | 6-thiophen-3-ylfuro[2,3-h]quinoline |
| PubChem CID | 142737835 |
| Molecular Formula | C15H9NOS |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 6-thiophen-3-ylfuro[2,3-h]quinoline |
| SMILES | c1cnc2c(c1)cc(-c1ccsc1)c1occc12 |
| InChI | InChI=1S/C15H9NOS/c1-2-10-8-13(11-4-7-18-9-11)15-12(3-6-17-15)14(10)16-5-1/h1-9H |
| InChIKey | UOGMCIDBLIZHDV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-thiophen-3-ylfuro[2,3-h]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-thiophen-3-ylfuro[2,3-h]quinoline?
The IUPAC name of 6-thiophen-3-ylfuro[2,3-h]quinoline (CID 142737835) is 6-thiophen-3-ylfuro[2,3-h]quinoline.
What is the SMILES notation for 6-thiophen-3-ylfuro[2,3-h]quinoline?
The canonical SMILES for 6-thiophen-3-ylfuro[2,3-h]quinoline is c1cnc2c(c1)cc(-c1ccsc1)c1occc12.
What is the InChIKey of 6-thiophen-3-ylfuro[2,3-h]quinoline?
The InChIKey is UOGMCIDBLIZHDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9NOS/c1-2-10-8-13(11-4-7-18-9-11)15-12(3-6-17-15)14(10)16-5-1/h1-9H.
What are the key properties of 6-thiophen-3-ylfuro[2,3-h]quinoline?
6-thiophen-3-ylfuro[2,3-h]quinoline has a molecular weight of 251.31 g/mol, XLogP of 4.71, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-thiophen-3-ylfuro[2,3-h]quinoline is sourced from PubChem (CID 142737835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).