C15H9NO — CID 58262105
3-oxa-8-azatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),8,10,13,15-octaene (PubChem CID 58262105) has the molecular formula C15H9NO and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-oxa-8-azatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),8,10,13,15-octaene.
| Compound Name | 3-oxa-8-azatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),8,10,13,15-octaene |
|---|---|
| PubChem CID | 58262105 |
| Molecular Formula | C15H9NO |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 3-oxa-8-azatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),8,10,13,15-octaene |
| SMILES | c1ccc2c(c1)c1cccnc1c1ccoc21 |
| InChI | InChI=1S/C15H9NO/c1-2-5-12-10(4-1)11-6-3-8-16-14(11)13-7-9-17-15(12)13/h1-9H |
| InChIKey | YCKSPLOQSCUQFU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|