C16H12N2O2 — CID 44587502
4-methoxy-11-methylfuro[3,2-c][1,10]phenanthroline (PubChem CID 44587502) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-methoxy-11-methylfuro[3,2-c][1,10]phenanthroline.
| Compound Name | 4-methoxy-11-methylfuro[3,2-c][1,10]phenanthroline |
|---|---|
| PubChem CID | 44587502 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 4-methoxy-11-methylfuro[3,2-c][1,10]phenanthroline |
| SMILES | COc1cc2cccnc2c2nc(C)c3ccoc3c12 |
| InChI | InChI=1S/C16H12N2O2/c1-9-11-5-7-20-16(11)13-12(19-2)8-10-4-3-6-17-14(10)15(13)18-9/h3-8H,1-2H3 |
| InChIKey | OORCXOKZLVUYTL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|