C26H46N2O5 — CID 142738234
tert-butyl N-[5-[2-(3-decyl-1,2-oxazol-5-yl)ethyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate (PubChem CID 142738234) has the molecular formula C26H46N2O5 and a molecular weight of 466.66 g/mol. Its IUPAC name is tert-butyl N-[5-[2-(3-decyl-1,2-oxazol-5-yl)ethyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate.
| Compound Name | tert-butyl N-[5-[2-(3-decyl-1,2-oxazol-5-yl)ethyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate |
|---|---|
| PubChem CID | 142738234 |
| Molecular Formula | C26H46N2O5 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | tert-butyl N-[5-[2-(3-decyl-1,2-oxazol-5-yl)ethyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate |
| SMILES | CCCCCCCCCCc1cc(CCC2(NC(=O)OC(C)(C)C)COC(C)(C)OC2)on1 |
| InChI | InChI=1S/C26H46N2O5/c1-7-8-9-10-11-12-13-14-15-21-18-22(33-28-21)16-17-26(19-30-25(5,6)31-20-26)27-23(29)32-24(2,3)4/h18H,7-17,19-20H2,1-6H3,(H,27,29) |
| InChIKey | VVYAZFOZAITXIZ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|