About (2-propylmorpholin-2-yl) 2-hydroxypropanoate
(2-propylmorpholin-2-yl) 2-hydroxypropanoate (PubChem CID 142738252) has the molecular formula C10H19NO4
and a molecular weight of 217.26 g/mol. Its IUPAC name is (2-propylmorpholin-2-yl) 2-hydroxypropanoate.
Molecular Properties
| Compound Name | (2-propylmorpholin-2-yl) 2-hydroxypropanoate |
| PubChem CID | 142738252 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (2-propylmorpholin-2-yl) 2-hydroxypropanoate |
| SMILES | CCCC1(OC(=O)C(C)O)CNCCO1 |
| InChI | InChI=1S/C10H19NO4/c1-3-4-10(7-11-5-6-14-10)15-9(13)8(2)12/h8,11-12H,3-7H2,1-2H3 |
| InChIKey | CZGRCQTVWMAODN-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-propylmorpholin-2-yl) 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-propylmorpholin-2-yl) 2-hydroxypropanoate?
The IUPAC name of (2-propylmorpholin-2-yl) 2-hydroxypropanoate (CID 142738252) is (2-propylmorpholin-2-yl) 2-hydroxypropanoate.
What is the SMILES notation for (2-propylmorpholin-2-yl) 2-hydroxypropanoate?
The canonical SMILES for (2-propylmorpholin-2-yl) 2-hydroxypropanoate is CCCC1(OC(=O)C(C)O)CNCCO1.
What is the InChIKey of (2-propylmorpholin-2-yl) 2-hydroxypropanoate?
The InChIKey is CZGRCQTVWMAODN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO4/c1-3-4-10(7-11-5-6-14-10)15-9(13)8(2)12/h8,11-12H,3-7H2,1-2H3.
What are the key properties of (2-propylmorpholin-2-yl) 2-hydroxypropanoate?
(2-propylmorpholin-2-yl) 2-hydroxypropanoate has a molecular weight of 217.26 g/mol, XLogP of 0.03, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-propylmorpholin-2-yl) 2-hydroxypropanoate is sourced from PubChem (CID 142738252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).