C12H26O10 — CID 142738509
1-(5,5-dihydroperoxyhexylperoxy)-5,5-dihydroperoxyhexane (PubChem CID 142738509) has the molecular formula C12H26O10 and a molecular weight of 330.33 g/mol. Its IUPAC name is 1-(5,5-dihydroperoxyhexylperoxy)-5,5-dihydroperoxyhexane.
| Compound Name | 1-(5,5-dihydroperoxyhexylperoxy)-5,5-dihydroperoxyhexane |
|---|---|
| PubChem CID | 142738509 |
| Molecular Formula | C12H26O10 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1-(5,5-dihydroperoxyhexylperoxy)-5,5-dihydroperoxyhexane |
| SMILES | CC(CCCCOOCCCCC(C)(OO)OO)(OO)OO |
| InChI | InChI=1S/C12H26O10/c1-11(19-13,20-14)7-3-5-9-17-18-10-6-4-8-12(2,21-15)22-16/h13-16H,3-10H2,1-2H3 |
| InChIKey | LWBJFIXFVQBFSZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|