C21H45NO5 — CID 101137569
1-amino-2-[2-[2-[2-(10,10-dimethylundecoxy)ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 101137569) has the molecular formula C21H45NO5 and a molecular weight of 391.59 g/mol. Its IUPAC name is 1-amino-2-[2-[2-[2-(10,10-dimethylundecoxy)ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 1-amino-2-[2-[2-[2-(10,10-dimethylundecoxy)ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 101137569 |
| Molecular Formula | C21H45NO5 |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 391.33 |
| IUPAC Name | 1-amino-2-[2-[2-[2-(10,10-dimethylundecoxy)ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | CC(C)(C)CCCCCCCCCOCCOCCOCCOCC(N)O |
| InChI | InChI=1S/C21H45NO5/c1-21(2,3)11-9-7-5-4-6-8-10-12-24-13-14-25-15-16-26-17-18-27-19-20(22)23/h20,23H,4-19,22H2,1-3H3 |
| InChIKey | WPISWZWBPNZYHP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|