C26H28N4O4S — CID 142738850
3-[[3-[(1-benzylpiperidin-4-yl)sulfamoyl]benzoyl]amino]benzamide (PubChem CID 142738850) has the molecular formula C26H28N4O4S and a molecular weight of 492.60 g/mol. Its IUPAC name is 3-[[3-[(1-benzylpiperidin-4-yl)sulfamoyl]benzoyl]amino]benzamide.
| Compound Name | 3-[[3-[(1-benzylpiperidin-4-yl)sulfamoyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 142738850 |
| Molecular Formula | C26H28N4O4S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 3-[[3-[(1-benzylpiperidin-4-yl)sulfamoyl]benzoyl]amino]benzamide |
| SMILES | NC(=O)c1cccc(NC(=O)c2cccc(S(=O)(=O)NC3CCN(Cc4ccccc4)CC3)c2)c1 |
| InChI | InChI=1S/C26H28N4O4S/c27-25(31)20-8-4-10-23(16-20)28-26(32)21-9-5-11-24(17-21)35(33,34)29-22-12-14-30(15-13-22)18-19-6-2-1-3-7-19/h1-11,16-17,22,29H,12-15,18H2,(H2,27,31)(H,28,32) |
| InChIKey | PHHSNVLSBDLXLY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |