C16H26NOP — CID 142738926
8-di(propan-2-yl)phosphoryl-2-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 142738926) has the molecular formula C16H26NOP and a molecular weight of 279.36 g/mol. Its IUPAC name is 8-di(propan-2-yl)phosphoryl-2-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-di(propan-2-yl)phosphoryl-2-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 142738926 |
| Molecular Formula | C16H26NOP |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 8-di(propan-2-yl)phosphoryl-2-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1CCc2cccc(P(=O)(C(C)C)C(C)C)c2N1 |
| InChI | InChI=1S/C16H26NOP/c1-11(2)19(18,12(3)4)15-8-6-7-14-10-9-13(5)17-16(14)15/h6-8,11-13,17H,9-10H2,1-5H3 |
| InChIKey | CPFJAMZCCKMYSR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|