C19H27F9 — CID 14273942
1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-4-(4-propylcyclohexyl)cyclohexane (PubChem CID 14273942) has the molecular formula C19H27F9 and a molecular weight of 426.41 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-4-(4-propylcyclohexyl)cyclohexane.
| Compound Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-4-(4-propylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 14273942 |
| Molecular Formula | C19H27F9 |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-4-(4-propylcyclohexyl)cyclohexane |
| SMILES | CCCC1CCC(C2CCC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C19H27F9/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(11-9-14)16(20,21)17(22,23)18(24,25)19(26,27)28/h12-15H,2-11H2,1H3 |
| InChIKey | QPACQWMVDNJKMD-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|