C23H43NO4Si — CID 142740307
N-[3-[benzyl(dipropoxy)silyl]propyl]-3-methoxy-N-(2-methoxyethyl)propan-1-amine (PubChem CID 142740307) has the molecular formula C23H43NO4Si and a molecular weight of 425.69 g/mol. Its IUPAC name is N-[3-[benzyl(dipropoxy)silyl]propyl]-3-methoxy-N-(2-methoxyethyl)propan-1-amine.
| Compound Name | N-[3-[benzyl(dipropoxy)silyl]propyl]-3-methoxy-N-(2-methoxyethyl)propan-1-amine |
|---|---|
| PubChem CID | 142740307 |
| Molecular Formula | C23H43NO4Si |
| Molecular Weight | 425.69 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | N-[3-[benzyl(dipropoxy)silyl]propyl]-3-methoxy-N-(2-methoxyethyl)propan-1-amine |
| SMILES | CCCO[Si](CCCN(CCCOC)CCOC)(Cc1ccccc1)OCCC |
| InChI | InChI=1S/C23H43NO4Si/c1-5-17-27-29(28-18-6-2,22-23-12-8-7-9-13-23)21-11-15-24(16-20-26-4)14-10-19-25-3/h7-9,12-13H,5-6,10-11,14-22H2,1-4H3 |
| InChIKey | PMTJIOUUJHZGNM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.69 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|