C14H23NO2 — CID 16753331
N,N-bis(2-methoxyethyl)-2-phenylethanamine (PubChem CID 16753331) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-2-phenylethanamine.
| Compound Name | N,N-bis(2-methoxyethyl)-2-phenylethanamine |
|---|---|
| PubChem CID | 16753331 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-2-phenylethanamine |
| SMILES | COCCN(CCOC)CCc1ccccc1 |
| InChI | InChI=1S/C14H23NO2/c1-16-12-10-15(11-13-17-2)9-8-14-6-4-3-5-7-14/h3-7H,8-13H2,1-2H3 |
| InChIKey | XPKHCZPRDUYMPR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |