C16H25N3O3 — CID 51097264
N-carbamoyl-3-[2-methoxyethyl(3-phenylpropyl)amino]propanamide (PubChem CID 51097264) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-carbamoyl-3-[2-methoxyethyl(3-phenylpropyl)amino]propanamide.
| Compound Name | N-carbamoyl-3-[2-methoxyethyl(3-phenylpropyl)amino]propanamide |
|---|---|
| PubChem CID | 51097264 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | N-carbamoyl-3-[2-methoxyethyl(3-phenylpropyl)amino]propanamide |
| SMILES | COCCN(CCCc1ccccc1)CCC(=O)NC(N)=O |
| InChI | InChI=1S/C16H25N3O3/c1-22-13-12-19(11-9-15(20)18-16(17)21)10-5-8-14-6-3-2-4-7-14/h2-4,6-7H,5,8-13H2,1H3,(H3,17,18,20,21) |
| InChIKey | LHENCUMCKWJKQY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |