C16H26O2 — CID 142741582
8-(4-ethylcyclohex-3-en-1-yl)-1,4-dioxaspiro[4.5]decane (PubChem CID 142741582) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 8-(4-ethylcyclohex-3-en-1-yl)-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-(4-ethylcyclohex-3-en-1-yl)-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 142741582 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 8-(4-ethylcyclohex-3-en-1-yl)-1,4-dioxaspiro[4.5]decane |
| SMILES | CCC1=CCC(C2CCC3(CC2)OCCO3)CC1 |
| InChI | InChI=1S/C16H26O2/c1-2-13-3-5-14(6-4-13)15-7-9-16(10-8-15)17-11-12-18-16/h3,14-15H,2,4-12H2,1H3 |
| InChIKey | MOMUGNXNHOHHFS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|